C57H38N4 — CID 177275412
1,2,3,4-tetradeuterio-9-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-8-(4-phenylphenyl)carbazole (PubChem CID 177275412) has the molecular formula C57H38N4 and a molecular weight of 782.98 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-9-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-8-(4-phenylphenyl)carbazole.
| Compound Name | 1,2,3,4-tetradeuterio-9-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-8-(4-phenylphenyl)carbazole |
|---|---|
| PubChem CID | 177275412 |
| Molecular Formula | C57H38N4 |
| Molecular Weight | 782.98 g/mol |
| Exact Mass | 782.33 |
| IUPAC Name | 1,2,3,4-tetradeuterio-9-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-8-(4-phenylphenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1cccc(-c3ccc(-c4ccccc4)cc3)c1n2-c1nc(-c2ccc(-c3ccccc3)cc2)nc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C57H38N4/c1-5-16-39(17-6-1)43-28-32-45(33-29-43)50-25-15-26-52-51-24-13-14-27-53(51)61(54(50)52)57-59-55(46-34-30-44(31-35-46)40-18-7-2-8-19-40)58-56(60-57)49-37-47(41-20-9-3-10-21-41)36-48(38-49)42-22-11-4-12-23-42/h1-38H/i13D,14D,24D,27D |
| InChIKey | VDNGSQVWFUOCKE-MUVBDVEZSA-N |
| XLogP | 14.64 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.98 |
| LogP ≤ 5 | 14.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |