C57H36N4O — CID 177275444
1,2,3,4-tetradeuterio-9-[4-dibenzofuran-3-yl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-8-(3,5-diphenylphenyl)carbazole (PubChem CID 177275444) has the molecular formula C57H36N4O and a molecular weight of 796.97 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-9-[4-dibenzofuran-3-yl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-8-(3,5-diphenylphenyl)carbazole.
| Compound Name | 1,2,3,4-tetradeuterio-9-[4-dibenzofuran-3-yl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-8-(3,5-diphenylphenyl)carbazole |
|---|---|
| PubChem CID | 177275444 |
| Molecular Formula | C57H36N4O |
| Molecular Weight | 796.97 g/mol |
| Exact Mass | 796.31 |
| IUPAC Name | 1,2,3,4-tetradeuterio-9-[4-dibenzofuran-3-yl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-8-(3,5-diphenylphenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1cccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c1n2-c1nc(-c2cccc(-c3ccccc3)c2)nc(-c2ccc3c(c2)oc2ccccc23)n1 |
| InChI | InChI=1S/C57H36N4O/c1-4-16-37(17-5-1)40-22-14-23-41(32-40)55-58-56(42-30-31-49-48-25-11-13-29-52(48)62-53(49)36-42)60-57(59-55)61-51-28-12-10-24-47(51)50-27-15-26-46(54(50)61)45-34-43(38-18-6-2-7-19-38)33-44(35-45)39-20-8-3-9-21-39/h1-36H/i10D,12D,24D,28D |
| InChIKey | MKWFABARFSCIFM-QPLKJRJLSA-N |
| XLogP | 14.87 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.97 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |