C40H27NO — CID 170941966
4-(1,5,6,8,9,10,11-heptadeuterionaphtho[2,1-b][1]benzofuran-3-yl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-phenylaniline (PubChem CID 170941966) has the molecular formula C40H27NO and a molecular weight of 549.74 g/mol. Its IUPAC name is 4-(1,5,6,8,9,10,11-heptadeuterionaphtho[2,1-b][1]benzofuran-3-yl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-phenylaniline.
| Compound Name | 4-(1,5,6,8,9,10,11-heptadeuterionaphtho[2,1-b][1]benzofuran-3-yl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 170941966 |
| Molecular Formula | C40H27NO |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | 4-(1,5,6,8,9,10,11-heptadeuterionaphtho[2,1-b][1]benzofuran-3-yl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-phenylaniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(N(c3ccccc3)c3ccc(-c4cc([2H])c5c(c4)c([2H])c([2H])c4oc6c([2H])c([2H])c([2H])c([2H])c6c45)cc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C40H27NO/c1-3-9-28(10-4-1)29-15-21-34(22-16-29)41(33-11-5-2-6-12-33)35-23-17-30(18-24-35)31-19-25-36-32(27-31)20-26-39-40(36)37-13-7-8-14-38(37)42-39/h1-27H/i1D,3D,4D,7D,8D,9D,10D,13D,14D,20D,25D,26D |
| InChIKey | GDWWRSOQAIAYDU-SZXCCCAKSA-N |
| XLogP | 11.54 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |