C52H35NO — CID 177130822
3,5-dideuterio-4-[3,4,5,6,8,10-hexadeuterio-2-(2,3,4,5,6-pentadeuteriophenyl)naphtho[2,1-b][1]benzofuran-9-yl]-N,N-bis(4-phenylphenyl)aniline (PubChem CID 177130822) has the molecular formula C52H35NO and a molecular weight of 702.94 g/mol. Its IUPAC name is 3,5-dideuterio-4-[3,4,5,6,8,10-hexadeuterio-2-(2,3,4,5,6-pentadeuteriophenyl)naphtho[2,1-b][1]benzofuran-9-yl]-N,N-bis(4-phenylphenyl)aniline.
| Compound Name | 3,5-dideuterio-4-[3,4,5,6,8,10-hexadeuterio-2-(2,3,4,5,6-pentadeuteriophenyl)naphtho[2,1-b][1]benzofuran-9-yl]-N,N-bis(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 177130822 |
| Molecular Formula | C52H35NO |
| Molecular Weight | 702.94 g/mol |
| Exact Mass | 702.35 |
| IUPAC Name | 3,5-dideuterio-4-[3,4,5,6,8,10-hexadeuterio-2-(2,3,4,5,6-pentadeuteriophenyl)naphtho[2,1-b][1]benzofuran-9-yl]-N,N-bis(4-phenylphenyl)aniline |
| SMILES | [2H]c1cc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)cc([2H])c1-c1c([2H])cc2c(oc3c([2H])c([2H])c4c([2H])c([2H])c(-c5c([2H])c([2H])c([2H])c([2H])c5[2H])cc4c32)c1[2H] |
| InChI | InChI=1S/C52H35NO/c1-4-10-36(11-5-1)39-18-26-45(27-19-39)53(46-28-20-40(21-29-46)37-12-6-2-7-13-37)47-30-22-41(23-31-47)44-24-32-48-51(35-44)54-50-33-25-42-16-17-43(34-49(42)52(48)50)38-14-8-3-9-15-38/h1-35H/i3D,8D,9D,14D,15D,16D,17D,22D,23D,24D,25D,33D,35D |
| InChIKey | PMXKZTIQYRCNGG-GOIPJJOKSA-N |
| XLogP | 14.88 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.94 |
| LogP ≤ 5 | 14.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |