C40H27NO — CID 177287427
7-[1,3,4,5,7,8-hexadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-N,N-diphenyldibenzofuran-3-amine (PubChem CID 177287427) has the molecular formula C40H27NO and a molecular weight of 548.73 g/mol. Its IUPAC name is 7-[1,3,4,5,7,8-hexadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-N,N-diphenyldibenzofuran-3-amine.
| Compound Name | 7-[1,3,4,5,7,8-hexadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-N,N-diphenyldibenzofuran-3-amine |
|---|---|
| PubChem CID | 177287427 |
| Molecular Formula | C40H27NO |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | 7-[1,3,4,5,7,8-hexadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-N,N-diphenyldibenzofuran-3-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c3c([2H])c(-c4ccc5c(c4)oc4cc(N(c6ccccc6)c6ccccc6)ccc45)c([2H])c([2H])c3c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C40H27NO/c1-4-10-28(11-5-1)29-16-17-31-25-32(19-18-30(31)24-29)33-20-22-37-38-23-21-36(27-40(38)42-39(37)26-33)41(34-12-6-2-7-13-34)35-14-8-3-9-15-35/h1-27H/i1D,4D,5D,10D,11D,16D,17D,18D,19D,24D,25D |
| InChIKey | LDOOMLRJSJVPOL-FNRAGLAKSA-N |
| XLogP | 11.54 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |