C48H31NO2 — CID 171450972
2,3,5,6-tetradeuterio-N,N-bis(4-dibenzofuran-3-ylphenyl)-4-phenylaniline (PubChem CID 171450972) has the molecular formula C48H31NO2 and a molecular weight of 657.81 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N,N-bis(4-dibenzofuran-3-ylphenyl)-4-phenylaniline.
| Compound Name | 2,3,5,6-tetradeuterio-N,N-bis(4-dibenzofuran-3-ylphenyl)-4-phenylaniline |
|---|---|
| PubChem CID | 171450972 |
| Molecular Formula | C48H31NO2 |
| Molecular Weight | 657.81 g/mol |
| Exact Mass | 657.26 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N,N-bis(4-dibenzofuran-3-ylphenyl)-4-phenylaniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3ccc4c(c3)oc3ccccc34)cc2)c2ccc(-c3ccc4c(c3)oc3ccccc34)cc2)c([2H])c([2H])c1-c1ccccc1 |
| InChI | InChI=1S/C48H31NO2/c1-2-8-32(9-3-1)33-14-22-38(23-15-33)49(39-24-16-34(17-25-39)36-20-28-43-41-10-4-6-12-45(41)50-47(43)30-36)40-26-18-35(19-27-40)37-21-29-44-42-11-5-7-13-46(42)51-48(44)31-37/h1-31H/i14D,15D,22D,23D |
| InChIKey | DHQPUVHJCKHHOX-YLXGMRDISA-N |
| XLogP | 13.96 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.81 |
| LogP ≤ 5 | 13.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |