C48H31NO2 — CID 171452184
2,3,5,6-tetradeuterio-N-(4-dibenzofuran-3-ylphenyl)-4-phenyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-3-ylphenyl)aniline (PubChem CID 171452184) has the molecular formula C48H31NO2 and a molecular weight of 661.83 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N-(4-dibenzofuran-3-ylphenyl)-4-phenyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-3-ylphenyl)aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N-(4-dibenzofuran-3-ylphenyl)-4-phenyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-3-ylphenyl)aniline |
|---|---|
| PubChem CID | 171452184 |
| Molecular Formula | C48H31NO2 |
| Molecular Weight | 661.83 g/mol |
| Exact Mass | 661.29 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N-(4-dibenzofuran-3-ylphenyl)-4-phenyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-3-ylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3ccc4c(c3)oc3ccccc34)cc2)c2c([2H])c([2H])c(-c3ccc4c(c3)oc3ccccc34)c([2H])c2[2H])c([2H])c([2H])c1-c1ccccc1 |
| InChI | InChI=1S/C48H31NO2/c1-2-8-32(9-3-1)33-14-22-38(23-15-33)49(39-24-16-34(17-25-39)36-20-28-43-41-10-4-6-12-45(41)50-47(43)30-36)40-26-18-35(19-27-40)37-21-29-44-42-11-5-7-13-46(42)51-48(44)31-37/h1-31H/i14D,15D,16D,17D,22D,23D,24D,25D |
| InChIKey | DHQPUVHJCKHHOX-MLMAOEDBSA-N |
| XLogP | 13.96 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.83 |
| LogP ≤ 5 | 13.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |