C42H27NO2 — CID 171452943
N-(2,3,5,6-tetradeuterio-4-dibenzofuran-3-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)dibenzofuran-3-amine (PubChem CID 171452943) has the molecular formula C42H27NO2 and a molecular weight of 585.73 g/mol. Its IUPAC name is N-(2,3,5,6-tetradeuterio-4-dibenzofuran-3-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)dibenzofuran-3-amine.
| Compound Name | N-(2,3,5,6-tetradeuterio-4-dibenzofuran-3-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)dibenzofuran-3-amine |
|---|---|
| PubChem CID | 171452943 |
| Molecular Formula | C42H27NO2 |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | N-(2,3,5,6-tetradeuterio-4-dibenzofuran-3-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)dibenzofuran-3-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc3c(c2)oc2ccccc23)c2c([2H])c([2H])c(-c3ccc4c(c3)oc3ccccc34)c([2H])c2[2H])c([2H])c([2H])c1-c1ccccc1 |
| InChI | InChI=1S/C42H27NO2/c1-2-8-28(9-3-1)29-14-19-32(20-15-29)43(34-23-25-38-36-11-5-7-13-40(36)45-42(38)27-34)33-21-16-30(17-22-33)31-18-24-37-35-10-4-6-12-39(35)44-41(37)26-31/h1-27H/i14D,15D,16D,17D,19D,20D,21D,22D |
| InChIKey | SZTCFGANSXHHCK-RFBZRUDWSA-N |
| XLogP | 12.29 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |