C42H29NO — CID 171451950
2,3,5,6-tetradeuterio-4-dibenzofuran-3-yl-N,N-bis(4-phenylphenyl)aniline (PubChem CID 171451950) has the molecular formula C42H29NO and a molecular weight of 567.72 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-dibenzofuran-3-yl-N,N-bis(4-phenylphenyl)aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-dibenzofuran-3-yl-N,N-bis(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 171451950 |
| Molecular Formula | C42H29NO |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-dibenzofuran-3-yl-N,N-bis(4-phenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)c([2H])c([2H])c1-c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C42H29NO/c1-3-9-30(10-4-1)32-15-22-36(23-16-32)43(37-24-17-33(18-25-37)31-11-5-2-6-12-31)38-26-19-34(20-27-38)35-21-28-40-39-13-7-8-14-41(39)44-42(40)29-35/h1-29H/i19D,20D,26D,27D |
| InChIKey | RSXFUWJSSRRXGW-HSIITGJVSA-N |
| XLogP | 12.06 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |