C44H29NO — CID 167339270
N-[4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]-6-(2,3,4,5,6-pentadeuteriophenyl)-N-phenylnaphtho[1,2-b][1]benzofuran-8-amine (PubChem CID 167339270) has the molecular formula C44H29NO and a molecular weight of 599.80 g/mol. Its IUPAC name is N-[4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]-6-(2,3,4,5,6-pentadeuteriophenyl)-N-phenylnaphtho[1,2-b][1]benzofuran-8-amine.
| Compound Name | N-[4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]-6-(2,3,4,5,6-pentadeuteriophenyl)-N-phenylnaphtho[1,2-b][1]benzofuran-8-amine |
|---|---|
| PubChem CID | 167339270 |
| Molecular Formula | C44H29NO |
| Molecular Weight | 599.80 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | N-[4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]-6-(2,3,4,5,6-pentadeuteriophenyl)-N-phenylnaphtho[1,2-b][1]benzofuran-8-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc3ccccc3c3oc4ccc(N(c5ccccc5)c5ccc(-c6c([2H])c([2H])c7c([2H])c([2H])c([2H])c([2H])c7c6[2H])cc5)cc4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C44H29NO/c1-3-12-32(13-4-1)40-28-35-15-9-10-18-39(35)44-43(40)41-29-38(25-26-42(41)46-44)45(36-16-5-2-6-17-36)37-23-21-31(22-24-37)34-20-19-30-11-7-8-14-33(30)27-34/h1-29H/i1D,3D,4D,7D,8D,11D,12D,13D,14D,19D,20D,27D |
| InChIKey | ZAVDRNDWFRFBDD-LUPFJFQMSA-N |
| XLogP | 12.70 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.80 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |