C46H29NO2 — CID 177287271
N-dibenzofuran-3-yl-N-[2,3,5,6-tetradeuterio-4-[1,4,5,6,7,8-hexadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]phenyl]dibenzofuran-3-amine (PubChem CID 177287271) has the molecular formula C46H29NO2 and a molecular weight of 642.83 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-N-[2,3,5,6-tetradeuterio-4-[1,4,5,6,7,8-hexadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]phenyl]dibenzofuran-3-amine.
| Compound Name | N-dibenzofuran-3-yl-N-[2,3,5,6-tetradeuterio-4-[1,4,5,6,7,8-hexadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]phenyl]dibenzofuran-3-amine |
|---|---|
| PubChem CID | 177287271 |
| Molecular Formula | C46H29NO2 |
| Molecular Weight | 642.83 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | N-dibenzofuran-3-yl-N-[2,3,5,6-tetradeuterio-4-[1,4,5,6,7,8-hexadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]phenyl]dibenzofuran-3-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(-c3c([2H])c([2H])c(N(c4ccc5c(c4)oc4ccccc45)c4ccc5c(c4)oc4ccccc45)c([2H])c3[2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c3c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C46H29NO2/c1-2-10-30(11-3-1)41-26-32-12-4-5-13-33(32)27-42(41)31-18-20-34(21-19-31)47(35-22-24-39-37-14-6-8-16-43(37)48-45(39)28-35)36-23-25-40-38-15-7-9-17-44(38)49-46(40)29-36/h1-29H/i1D,2D,3D,4D,5D,10D,11D,12D,13D,18D,19D,20D,21D,26D,27D |
| InChIKey | PEJSUCBESHTALI-CJTSTRHLSA-N |
| XLogP | 13.44 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.83 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |