C44H29NO — CID 177287250
N-naphthalen-1-yl-N-[2,3,5,6-tetradeuterio-4-[3,4,5,6,7,8-hexadeuterio-1-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]phenyl]dibenzofuran-3-amine (PubChem CID 177287250) has the molecular formula C44H29NO and a molecular weight of 602.81 g/mol. Its IUPAC name is N-naphthalen-1-yl-N-[2,3,5,6-tetradeuterio-4-[3,4,5,6,7,8-hexadeuterio-1-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]phenyl]dibenzofuran-3-amine.
| Compound Name | N-naphthalen-1-yl-N-[2,3,5,6-tetradeuterio-4-[3,4,5,6,7,8-hexadeuterio-1-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]phenyl]dibenzofuran-3-amine |
|---|---|
| PubChem CID | 177287250 |
| Molecular Formula | C44H29NO |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | N-naphthalen-1-yl-N-[2,3,5,6-tetradeuterio-4-[3,4,5,6,7,8-hexadeuterio-1-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]phenyl]dibenzofuran-3-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(-c3c([2H])c([2H])c(N(c4ccc5c(c4)oc4ccccc45)c4cccc5ccccc45)c([2H])c3[2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C44H29NO/c1-2-13-33(14-3-1)44-37-17-7-5-12-31(37)23-27-38(44)32-21-24-34(25-22-32)45(41-19-10-15-30-11-4-6-16-36(30)41)35-26-28-40-39-18-8-9-20-42(39)46-43(40)29-35/h1-29H/i1D,2D,3D,5D,7D,12D,13D,14D,17D,21D,22D,23D,24D,25D,27D |
| InChIKey | SKXYOCARVZQSQH-HZKSVCRDSA-N |
| XLogP | 12.70 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |