C55H36N4O — CID 171597225
9-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(4-phenylnaphthalen-1-yl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzofuran-3-amine (PubChem CID 171597225) has the molecular formula C55H36N4O and a molecular weight of 777.97 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(4-phenylnaphthalen-1-yl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzofuran-3-amine.
| Compound Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(4-phenylnaphthalen-1-yl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzofuran-3-amine |
|---|---|
| PubChem CID | 171597225 |
| Molecular Formula | C55H36N4O |
| Molecular Weight | 777.97 g/mol |
| Exact Mass | 777.35 |
| IUPAC Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(4-phenylnaphthalen-1-yl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzofuran-3-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N(c3ccc4c(c3)oc3cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c34)c3ccc(-c4ccccc4)c4ccccc34)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C55H36N4O/c1-5-16-37(17-6-1)38-28-30-42(31-29-38)59(49-35-34-44(39-18-7-2-8-19-39)45-24-13-14-25-46(45)49)43-32-33-47-51(36-43)60-50-27-15-26-48(52(47)50)55-57-53(40-20-9-3-10-21-40)56-54(58-55)41-22-11-4-12-23-41/h1-36H/i1D,5D,6D,16D,17D,28D,29D,30D,31D |
| InChIKey | PSVLRZBEFOKMMU-HYWQOCSFSA-N |
| XLogP | 14.73 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.97 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |