C57H38N4O — CID 169048402
4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-N,N-bis(4-phenylphenyl)dibenzofuran-1-amine (PubChem CID 169048402) has the molecular formula C57H38N4O and a molecular weight of 799.99 g/mol. Its IUPAC name is 4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-N,N-bis(4-phenylphenyl)dibenzofuran-1-amine.
| Compound Name | 4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-N,N-bis(4-phenylphenyl)dibenzofuran-1-amine |
|---|---|
| PubChem CID | 169048402 |
| Molecular Formula | C57H38N4O |
| Molecular Weight | 799.99 g/mol |
| Exact Mass | 799.34 |
| IUPAC Name | 4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-N,N-bis(4-phenylphenyl)dibenzofuran-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3cccc(-c4ccccc4)c3)nc(-c3ccc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)cc4)c4c3oc3ccccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C57H38N4O/c1-5-16-39(17-6-1)42-28-32-47(33-29-42)61(48-34-30-43(31-35-48)40-18-7-2-8-19-40)51-37-36-50(54-53(51)49-26-13-14-27-52(49)62-54)57-59-55(44-22-11-4-12-23-44)58-56(60-57)46-25-15-24-45(38-46)41-20-9-3-10-21-41/h1-38H/i4D,11D,12D,22D,23D |
| InChIKey | AOWGDWPNGGFXFL-TTXKNQTFSA-N |
| XLogP | 15.24 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.99 |
| LogP ≤ 5 | 15.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |