C52H33NO2 — CID 155609733
7-(4,6,7,8,9,10,11-heptadeuterio-2,3-diphenylphenanthro[9,10-b]furan-5-yl)-N,N-diphenyldibenzofuran-3-amine (PubChem CID 155609733) has the molecular formula C52H33NO2 and a molecular weight of 710.88 g/mol. Its IUPAC name is 7-(4,6,7,8,9,10,11-heptadeuterio-2,3-diphenylphenanthro[9,10-b]furan-5-yl)-N,N-diphenyldibenzofuran-3-amine.
| Compound Name | 7-(4,6,7,8,9,10,11-heptadeuterio-2,3-diphenylphenanthro[9,10-b]furan-5-yl)-N,N-diphenyldibenzofuran-3-amine |
|---|---|
| PubChem CID | 155609733 |
| Molecular Formula | C52H33NO2 |
| Molecular Weight | 710.88 g/mol |
| Exact Mass | 710.30 |
| IUPAC Name | 7-(4,6,7,8,9,10,11-heptadeuterio-2,3-diphenylphenanthro[9,10-b]furan-5-yl)-N,N-diphenyldibenzofuran-3-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1oc(-c3ccccc3)c(-c3ccccc3)c1c1c([2H])c(-c3ccc4c(c3)oc3cc(N(c5ccccc5)c5ccccc5)ccc34)c([2H])c([2H])c21 |
| InChI | InChI=1S/C52H33NO2/c1-5-15-34(16-6-1)49-50-46-31-36(25-28-42(46)41-23-13-14-24-45(41)52(50)55-51(49)35-17-7-2-8-18-35)37-26-29-43-44-30-27-40(33-48(44)54-47(43)32-37)53(38-19-9-3-10-20-38)39-21-11-4-12-22-39/h1-33H/i13D,14D,23D,24D,25D,28D,31D |
| InChIKey | NSFAWNWRCNZTNF-JSVWPIDESA-N |
| XLogP | 15.11 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.88 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|