C52H32F3NO — CID 155609727
2,3,4,5,6-pentadeuterio-N-[4-(2,3-diphenylphenanthro[9,10-b]furan-5-yl)phenyl]-N-[4-(2,4,6-trifluorophenyl)phenyl]aniline (PubChem CID 155609727) has the molecular formula C52H32F3NO and a molecular weight of 748.86 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuterio-N-[4-(2,3-diphenylphenanthro[9,10-b]furan-5-yl)phenyl]-N-[4-(2,4,6-trifluorophenyl)phenyl]aniline.
| Compound Name | 2,3,4,5,6-pentadeuterio-N-[4-(2,3-diphenylphenanthro[9,10-b]furan-5-yl)phenyl]-N-[4-(2,4,6-trifluorophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 155609727 |
| Molecular Formula | C52H32F3NO |
| Molecular Weight | 748.86 g/mol |
| Exact Mass | 748.27 |
| IUPAC Name | 2,3,4,5,6-pentadeuterio-N-[4-(2,3-diphenylphenanthro[9,10-b]furan-5-yl)phenyl]-N-[4-(2,4,6-trifluorophenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccc(-c3ccc4c5ccccc5c5oc(-c6ccccc6)c(-c6ccccc6)c5c4c3)cc2)c2ccc(-c3c(F)cc(F)cc3F)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C52H32F3NO/c53-38-31-46(54)48(47(55)32-38)35-22-27-41(28-23-35)56(39-16-8-3-9-17-39)40-25-20-33(21-26-40)37-24-29-43-42-18-10-11-19-44(42)52-50(45(43)30-37)49(34-12-4-1-5-13-34)51(57-52)36-14-6-2-7-15-36/h1-32H/i3D,8D,9D,16D,17D |
| InChIKey | RMABOAMFWMLXHZ-VRDWFHIRSA-N |
| XLogP | 15.29 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.86 |
| LogP ≤ 5 | 15.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|