C40H27NO — CID 170941936
2,3,4,5,6-pentadeuterio-N-[4-(1,3,4,5,6,8,9,10,11-nonadeuterionaphtho[2,1-b][1]benzofuran-2-yl)phenyl]-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline (PubChem CID 170941936) has the molecular formula C40H27NO and a molecular weight of 556.78 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuterio-N-[4-(1,3,4,5,6,8,9,10,11-nonadeuterionaphtho[2,1-b][1]benzofuran-2-yl)phenyl]-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline.
| Compound Name | 2,3,4,5,6-pentadeuterio-N-[4-(1,3,4,5,6,8,9,10,11-nonadeuterionaphtho[2,1-b][1]benzofuran-2-yl)phenyl]-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 170941936 |
| Molecular Formula | C40H27NO |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | 2,3,4,5,6-pentadeuterio-N-[4-(1,3,4,5,6,8,9,10,11-nonadeuterionaphtho[2,1-b][1]benzofuran-2-yl)phenyl]-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(N(c3ccc(-c4c([2H])c([2H])c5c([2H])c([2H])c6oc7c([2H])c([2H])c([2H])c([2H])c7c6c5c4[2H])cc3)c3c([2H])c([2H])c([2H])c([2H])c3[2H])cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C40H27NO/c1-3-9-28(10-4-1)29-17-22-34(23-18-29)41(33-11-5-2-6-12-33)35-24-19-30(20-25-35)32-16-15-31-21-26-39-40(37(31)27-32)36-13-7-8-14-38(36)42-39/h1-27H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,21D,26D,27D |
| InChIKey | CERYDMBZZVUUNT-JQVKWIRNSA-N |
| XLogP | 11.54 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |