C52H33NO2 — CID 170941628
N-[4-[4-(1,5,6,8,9,10,11-heptadeuterionaphtho[2,1-b][1]benzofuran-2-yl)phenyl]phenyl]-N-[4-(2,4,6-trideuteriophenyl)phenyl]dibenzofuran-1-amine (PubChem CID 170941628) has the molecular formula C52H33NO2 and a molecular weight of 713.90 g/mol. Its IUPAC name is N-[4-[4-(1,5,6,8,9,10,11-heptadeuterionaphtho[2,1-b][1]benzofuran-2-yl)phenyl]phenyl]-N-[4-(2,4,6-trideuteriophenyl)phenyl]dibenzofuran-1-amine.
| Compound Name | N-[4-[4-(1,5,6,8,9,10,11-heptadeuterionaphtho[2,1-b][1]benzofuran-2-yl)phenyl]phenyl]-N-[4-(2,4,6-trideuteriophenyl)phenyl]dibenzofuran-1-amine |
|---|---|
| PubChem CID | 170941628 |
| Molecular Formula | C52H33NO2 |
| Molecular Weight | 713.90 g/mol |
| Exact Mass | 713.31 |
| IUPAC Name | N-[4-[4-(1,5,6,8,9,10,11-heptadeuterionaphtho[2,1-b][1]benzofuran-2-yl)phenyl]phenyl]-N-[4-(2,4,6-trideuteriophenyl)phenyl]dibenzofuran-1-amine |
| SMILES | [2H]c1cc([2H])c(-c2ccc(N(c3ccc(-c4ccc(-c5ccc6c([2H])c([2H])c7oc8c([2H])c([2H])c([2H])c([2H])c8c7c6c5[2H])cc4)cc3)c3cccc4oc5ccccc5c34)cc2)c([2H])c1 |
| InChI | InChI=1S/C52H33NO2/c1-2-9-34(10-3-1)36-23-28-41(29-24-36)53(46-13-8-16-49-52(46)44-12-5-7-15-48(44)54-49)42-30-25-37(26-31-42)35-17-19-38(20-18-35)40-22-21-39-27-32-50-51(45(39)33-40)43-11-4-6-14-47(43)55-50/h1-33H/i1D,4D,6D,9D,10D,11D,14D,27D,32D,33D |
| InChIKey | NNRUEMQAFOKOGG-OXDSCPSISA-N |
| XLogP | 15.11 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.90 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |