C44H29NO — CID 170941942
N-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-7-(1,5,6,11-tetradeuterionaphtho[2,1-b][1]benzofuran-2-yl)naphthalen-2-amine (PubChem CID 170941942) has the molecular formula C44H29NO and a molecular weight of 601.81 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-7-(1,5,6,11-tetradeuterionaphtho[2,1-b][1]benzofuran-2-yl)naphthalen-2-amine.
| Compound Name | N-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-7-(1,5,6,11-tetradeuterionaphtho[2,1-b][1]benzofuran-2-yl)naphthalen-2-amine |
|---|---|
| PubChem CID | 170941942 |
| Molecular Formula | C44H29NO |
| Molecular Weight | 601.81 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | N-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-7-(1,5,6,11-tetradeuterionaphtho[2,1-b][1]benzofuran-2-yl)naphthalen-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(N(c3ccc4ccc(-c5ccc6c([2H])c([2H])c7oc8cccc([2H])c8c7c6c5[2H])cc4c3)c3c([2H])c([2H])c([2H])c([2H])c3[2H])cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C44H29NO/c1-3-9-30(10-4-1)31-19-23-38(24-20-31)45(37-11-5-2-6-12-37)39-25-21-32-15-17-34(27-36(32)28-39)35-18-16-33-22-26-43-44(41(33)29-35)40-13-7-8-14-42(40)46-43/h1-29H/i1D,2D,3D,4D,5D,6D,9D,10D,11D,12D,13D,22D,26D,29D |
| InChIKey | OQUKQRATKMTULC-JYOJHNQPSA-N |
| XLogP | 12.70 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.81 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |