C50H35N — CID 171451203
2,3,5,6-tetradeuterio-N-(3-naphthalen-2-ylphenyl)-N-(4-naphthalen-2-ylphenyl)-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline (PubChem CID 171451203) has the molecular formula C50H35N and a molecular weight of 662.92 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N-(3-naphthalen-2-ylphenyl)-N-(4-naphthalen-2-ylphenyl)-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N-(3-naphthalen-2-ylphenyl)-N-(4-naphthalen-2-ylphenyl)-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 171451203 |
| Molecular Formula | C50H35N |
| Molecular Weight | 662.92 g/mol |
| Exact Mass | 662.36 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N-(3-naphthalen-2-ylphenyl)-N-(4-naphthalen-2-ylphenyl)-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(-c3c([2H])c([2H])c(N(c4ccc(-c5ccc6ccccc6c5)cc4)c4cccc(-c5ccc6ccccc6c5)c4)c([2H])c3[2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C50H35N/c1-2-9-36(10-3-1)39-17-19-40(20-18-39)41-25-29-48(30-26-41)51(49-31-27-42(28-32-49)46-23-21-37-11-4-6-13-43(37)33-46)50-16-8-15-45(35-50)47-24-22-38-12-5-7-14-44(38)34-47/h1-35H/i1D,2D,3D,9D,10D,17D,18D,19D,20D,25D,26D,29D,30D |
| InChIKey | GKIZDDRTRPIOMI-DMNPKMEBSA-N |
| XLogP | 14.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.92 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |