C44H31N — CID 171452131
2,3,5,6-tetradeuterio-N,N-bis(3-naphthalen-2-ylphenyl)-4-phenylaniline (PubChem CID 171452131) has the molecular formula C44H31N and a molecular weight of 577.76 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N,N-bis(3-naphthalen-2-ylphenyl)-4-phenylaniline.
| Compound Name | 2,3,5,6-tetradeuterio-N,N-bis(3-naphthalen-2-ylphenyl)-4-phenylaniline |
|---|---|
| PubChem CID | 171452131 |
| Molecular Formula | C44H31N |
| Molecular Weight | 577.76 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N,N-bis(3-naphthalen-2-ylphenyl)-4-phenylaniline |
| SMILES | [2H]c1c([2H])c(N(c2cccc(-c3ccc4ccccc4c3)c2)c2cccc(-c3ccc4ccccc4c3)c2)c([2H])c([2H])c1-c1ccccc1 |
| InChI | InChI=1S/C44H31N/c1-2-10-32(11-3-1)35-24-26-42(27-25-35)45(43-18-8-16-38(30-43)40-22-20-33-12-4-6-14-36(33)28-40)44-19-9-17-39(31-44)41-23-21-34-13-5-7-15-37(34)29-41/h1-31H/i24D,25D,26D,27D |
| InChIKey | FAYCCJGWYGVMJT-ZTHNUDSJSA-N |
| XLogP | 12.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.76 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |