C44H27NO — CID 166032595
N-[16-(2,3,4,5,6-pentadeuteriophenyl)-6-pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaenyl]-N-phenyldibenzofuran-4-amine (PubChem CID 166032595) has the molecular formula C44H27NO and a molecular weight of 590.74 g/mol. Its IUPAC name is N-[16-(2,3,4,5,6-pentadeuteriophenyl)-6-pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaenyl]-N-phenyldibenzofuran-4-amine.
| Compound Name | N-[16-(2,3,4,5,6-pentadeuteriophenyl)-6-pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaenyl]-N-phenyldibenzofuran-4-amine |
|---|---|
| PubChem CID | 166032595 |
| Molecular Formula | C44H27NO |
| Molecular Weight | 590.74 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | N-[16-(2,3,4,5,6-pentadeuteriophenyl)-6-pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(12),2(11),3,5,7,9,13,15,17,19-decaenyl]-N-phenyldibenzofuran-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3cc4c(cc3c2)-c2cc3ccc(N(c5ccccc5)c5cccc6c5oc5ccccc56)cc3cc2-4)c([2H])c1[2H] |
| InChI | InChI=1S/C44H27NO/c1-3-10-28(11-4-1)29-18-19-30-24-38-40(26-32(30)22-29)39-25-31-20-21-35(23-33(31)27-41(38)39)45(34-12-5-2-6-13-34)42-16-9-15-37-36-14-7-8-17-43(36)46-44(37)42/h1-27H/i1D,3D,4D,10D,11D |
| InChIKey | BBKXEVCMEWGLSN-PTWMICIRSA-N |
| XLogP | 12.68 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.74 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |