C48H33NO — CID 164744369
N-[4-(2-phenylphenyl)phenyl]-N-[4-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]dibenzofuran-4-amine (PubChem CID 164744369) has the molecular formula C48H33NO and a molecular weight of 648.85 g/mol. Its IUPAC name is N-[4-(2-phenylphenyl)phenyl]-N-[4-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]dibenzofuran-4-amine.
| Compound Name | N-[4-(2-phenylphenyl)phenyl]-N-[4-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]dibenzofuran-4-amine |
|---|---|
| PubChem CID | 164744369 |
| Molecular Formula | C48H33NO |
| Molecular Weight | 648.85 g/mol |
| Exact Mass | 648.31 |
| IUPAC Name | N-[4-(2-phenylphenyl)phenyl]-N-[4-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]dibenzofuran-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c([2H])c2-c2ccc(N(c3ccc(-c4ccccc4-c4ccccc4)cc3)c3cccc4c3oc3ccccc34)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C48H33NO/c1-3-14-34(15-4-1)40-18-7-9-20-42(40)36-26-30-38(31-27-36)49(46-24-13-23-45-44-22-11-12-25-47(44)50-48(45)46)39-32-28-37(29-33-39)43-21-10-8-19-41(43)35-16-5-2-6-17-35/h1-33H/i1D,3D,4D,7D,9D,14D,15D,18D,20D |
| InChIKey | USXVCDKPWKKFDP-XHCDZIRMSA-N |
| XLogP | 13.72 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.85 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |