C52H33NO2 — CID 170541977
2,3,5,6-tetradeuterio-N-(4-dibenzofuran-3-ylphenyl)-4-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N-(4-naphthalen-1-ylphenyl)aniline (PubChem CID 170541977) has the molecular formula C52H33NO2 and a molecular weight of 714.91 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N-(4-dibenzofuran-3-ylphenyl)-4-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N-(4-naphthalen-1-ylphenyl)aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N-(4-dibenzofuran-3-ylphenyl)-4-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N-(4-naphthalen-1-ylphenyl)aniline |
|---|---|
| PubChem CID | 170541977 |
| Molecular Formula | C52H33NO2 |
| Molecular Weight | 714.91 g/mol |
| Exact Mass | 714.32 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N-(4-dibenzofuran-3-ylphenyl)-4-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N-(4-naphthalen-1-ylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3ccc4c(c3)oc3ccccc34)cc2)c2ccc(-c3cccc4ccccc34)cc2)c([2H])c([2H])c1-c1c([2H])c([2H])c([2H])c2oc3c([2H])c([2H])c([2H])c([2H])c3c12 |
| InChI | InChI=1S/C52H33NO2/c1-2-11-42-35(9-1)10-7-14-43(42)36-21-28-40(29-22-36)53(39-26-19-34(20-27-39)38-25-32-46-45-12-3-5-16-48(45)55-51(46)33-38)41-30-23-37(24-31-41)44-15-8-18-50-52(44)47-13-4-6-17-49(47)54-50/h1-33H/i4D,6D,8D,13D,15D,17D,18D,23D,24D,30D,31D |
| InChIKey | RTBRJJIFHBHUDF-GGSGMNORSA-N |
| XLogP | 15.11 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.91 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |