C22H15Cl — CID 171417682
1-(3-chlorophenyl)-2,3,5,6,7,8-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)naphthalene (PubChem CID 171417682) has the molecular formula C22H15Cl and a molecular weight of 325.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2,3,5,6,7,8-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)naphthalene.
| Compound Name | 1-(3-chlorophenyl)-2,3,5,6,7,8-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)naphthalene |
|---|---|
| PubChem CID | 171417682 |
| Molecular Formula | C22H15Cl |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-(3-chlorophenyl)-2,3,5,6,7,8-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)naphthalene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(-c3cccc(Cl)c3)c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C22H15Cl/c23-18-10-6-9-17(15-18)20-14-13-19(16-7-2-1-3-8-16)21-11-4-5-12-22(20)21/h1-15H/i1D,2D,3D,4D,5D,7D,8D,11D,12D,13D,14D |
| InChIKey | ILCMNVALUNVUPJ-FRLRQXGNSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |