C24H15ClO — CID 171722122
6-(4-chlorophenyl)-2-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran (PubChem CID 171722122) has the molecular formula C24H15ClO and a molecular weight of 359.87 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran.
| Compound Name | 6-(4-chlorophenyl)-2-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran |
|---|---|
| PubChem CID | 171722122 |
| Molecular Formula | C24H15ClO |
| Molecular Weight | 359.87 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3oc4c(-c5ccc(Cl)cc5)cccc4c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C24H15ClO/c25-19-12-9-17(10-13-19)20-7-4-8-21-22-15-18(16-5-2-1-3-6-16)11-14-23(22)26-24(20)21/h1-15H/i1D,2D,3D,5D,6D |
| InChIKey | CBMCMHWMVYOJPU-XFEWCBMOSA-N |
| XLogP | 7.57 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.87 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |