C33H21N3O — CID 168769734
2,4-bis(2,3,4,5,6-pentadeuteriophenyl)-6-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]-1,3,5-triazine (PubChem CID 168769734) has the molecular formula C33H21N3O and a molecular weight of 490.64 g/mol. Its IUPAC name is 2,4-bis(2,3,4,5,6-pentadeuteriophenyl)-6-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]-1,3,5-triazine.
| Compound Name | 2,4-bis(2,3,4,5,6-pentadeuteriophenyl)-6-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 168769734 |
| Molecular Formula | C33H21N3O |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 2,4-bis(2,3,4,5,6-pentadeuteriophenyl)-6-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4oc5c(-c6c([2H])c([2H])c([2H])c([2H])c6[2H])cccc5c4c3)nc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])n2)c([2H])c1[2H] |
| InChI | InChI=1S/C33H21N3O/c1-4-11-22(12-5-1)26-17-10-18-27-28-21-25(19-20-29(28)37-30(26)27)33-35-31(23-13-6-2-7-14-23)34-32(36-33)24-15-8-3-9-16-24/h1-21H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,11D,12D,13D,14D,15D,16D |
| InChIKey | FUGPLFZGZPWHKY-BXIKQLKSSA-N |
| XLogP | 8.44 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |