C31H19N3O — CID 163512941
2-naphtho[2,3-b][1]benzofuran-2-yl-4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine (PubChem CID 163512941) has the molecular formula C31H19N3O and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-naphtho[2,3-b][1]benzofuran-2-yl-4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine.
| Compound Name | 2-naphtho[2,3-b][1]benzofuran-2-yl-4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 163512941 |
| Molecular Formula | C31H19N3O |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-naphtho[2,3-b][1]benzofuran-2-yl-4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4oc5cc6ccccc6cc5c4c3)nc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])n2)c([2H])c1[2H] |
| InChI | InChI=1S/C31H19N3O/c1-3-9-20(10-4-1)29-32-30(21-11-5-2-6-12-21)34-31(33-29)24-15-16-27-25(18-24)26-17-22-13-7-8-14-23(22)19-28(26)35-27/h1-19H/i1D,2D,3D,4D,5D,6D,9D,10D,11D,12D |
| InChIKey | SIJJBVPCUFPIKF-CRDOFXDFSA-N |
| XLogP | 7.93 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |