C41H25N3O — CID 163528916
2-(4-naphthalen-1-ylphenyl)-4-naphtho[2,3-b][1]benzofuran-3-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine (PubChem CID 163528916) has the molecular formula C41H25N3O and a molecular weight of 580.70 g/mol. Its IUPAC name is 2-(4-naphthalen-1-ylphenyl)-4-naphtho[2,3-b][1]benzofuran-3-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine.
| Compound Name | 2-(4-naphthalen-1-ylphenyl)-4-naphtho[2,3-b][1]benzofuran-3-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 163528916 |
| Molecular Formula | C41H25N3O |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | 2-(4-naphthalen-1-ylphenyl)-4-naphtho[2,3-b][1]benzofuran-3-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc(-c4cccc5ccccc45)cc3)nc(-c3ccc4c(c3)oc3cc5ccccc5cc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C41H25N3O/c1-2-10-28(11-3-1)39-42-40(29-19-17-27(18-20-29)34-16-8-14-26-9-6-7-15-33(26)34)44-41(43-39)32-21-22-35-36-23-30-12-4-5-13-31(30)24-38(36)45-37(35)25-32/h1-25H/i1D,2D,3D,10D,11D |
| InChIKey | NVICUCJCRUNGRU-PDNVFQDQSA-N |
| XLogP | 10.75 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |