C39H23N3O — CID 163618516
2-naphtho[2,3-b][1]benzofuran-4-yl-4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenanthren-9-yl-1,3,5-triazine (PubChem CID 163618516) has the molecular formula C39H23N3O and a molecular weight of 554.66 g/mol. Its IUPAC name is 2-naphtho[2,3-b][1]benzofuran-4-yl-4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenanthren-9-yl-1,3,5-triazine.
| Compound Name | 2-naphtho[2,3-b][1]benzofuran-4-yl-4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenanthren-9-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 163618516 |
| Molecular Formula | C39H23N3O |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 2-naphtho[2,3-b][1]benzofuran-4-yl-4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenanthren-9-yl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3cc4ccccc4c4ccccc34)nc(-c3cccc4c3oc3cc5ccccc5cc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C39H23N3O/c1-2-11-24(12-3-1)37-40-38(32-20-10-19-31-33-21-25-13-4-5-14-26(25)23-35(33)43-36(31)32)42-39(41-37)34-22-27-15-6-7-16-28(27)29-17-8-9-18-30(29)34/h1-23H/i1D,2D,3D,11D,12D |
| InChIKey | JOJKGGISNIONNF-QJJXXHCMSA-N |
| XLogP | 10.23 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|