C47H27N3O2 — CID 170927074
2-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-4-(3-naphtho[2,3-b][1]benzofuran-4-yldibenzofuran-1-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine (PubChem CID 170927074) has the molecular formula C47H27N3O2 and a molecular weight of 677.83 g/mol. Its IUPAC name is 2-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-4-(3-naphtho[2,3-b][1]benzofuran-4-yldibenzofuran-1-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine.
| Compound Name | 2-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-4-(3-naphtho[2,3-b][1]benzofuran-4-yldibenzofuran-1-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170927074 |
| Molecular Formula | C47H27N3O2 |
| Molecular Weight | 677.83 g/mol |
| Exact Mass | 677.29 |
| IUPAC Name | 2-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-4-(3-naphtho[2,3-b][1]benzofuran-4-yldibenzofuran-1-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3c([2H])c([2H])c4c([2H])c([2H])c([2H])c([2H])c4c3[2H])nc(-c3cc(-c4cccc5c4oc4cc6ccccc6cc45)cc4oc5ccccc5c34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C47H27N3O2/c1-2-12-29(13-3-1)45-48-46(33-22-21-28-11-4-5-14-30(28)23-33)50-47(49-45)39-25-34(27-42-43(39)37-17-8-9-20-40(37)51-42)35-18-10-19-36-38-24-31-15-6-7-16-32(31)26-41(38)52-44(35)36/h1-27H/i1D,2D,3D,4D,5D,11D,12D,13D,14D,21D,22D,23D |
| InChIKey | JTZCNMWUOLGNLH-FJRSTONQSA-N |
| XLogP | 12.64 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.83 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |