C21H12ClN3O — CID 153288146
2-chloro-4-dibenzofuran-2-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine (PubChem CID 153288146) has the molecular formula C21H12ClN3O and a molecular weight of 362.83 g/mol. Its IUPAC name is 2-chloro-4-dibenzofuran-2-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-dibenzofuran-2-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 153288146 |
| Molecular Formula | C21H12ClN3O |
| Molecular Weight | 362.83 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-chloro-4-dibenzofuran-2-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(Cl)nc(-c3ccc4oc5ccccc5c4c3)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C21H12ClN3O/c22-21-24-19(13-6-2-1-3-7-13)23-20(25-21)14-10-11-18-16(12-14)15-8-4-5-9-17(15)26-18/h1-12H/i1D,2D,3D,6D,7D |
| InChIKey | SHXRJHODWWVKAQ-FSTBWYLISA-N |
| XLogP | 5.76 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.83 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |