C39H25N3O — CID 168769980
2-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 168769980) has the molecular formula C39H25N3O and a molecular weight of 556.68 g/mol. Its IUPAC name is 2-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168769980 |
| Molecular Formula | C39H25N3O |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 2-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2oc2ccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)cc23)c([2H])c1[2H] |
| InChI | InChI=1S/C39H25N3O/c1-4-11-26(12-5-1)27-19-21-30(22-20-27)38-40-37(29-15-8-3-9-16-29)41-39(42-38)31-23-24-35-34(25-31)33-18-10-17-32(36(33)43-35)28-13-6-2-7-14-28/h1-25H/i2D,6D,7D,13D,14D |
| InChIKey | HLGKEMGYTRTRDM-RJAYAXDZSA-N |
| XLogP | 10.11 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |