C45H26N4O2 — CID 160655229
9-[6-[4-dibenzofuran-2-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]carbazole (PubChem CID 160655229) has the molecular formula C45H26N4O2 and a molecular weight of 659.76 g/mol. Its IUPAC name is 9-[6-[4-dibenzofuran-2-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]carbazole.
| Compound Name | 9-[6-[4-dibenzofuran-2-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]carbazole |
|---|---|
| PubChem CID | 160655229 |
| Molecular Formula | C45H26N4O2 |
| Molecular Weight | 659.76 g/mol |
| Exact Mass | 659.24 |
| IUPAC Name | 9-[6-[4-dibenzofuran-2-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4oc5ccccc5c4c3)nc(-c3cccc4c3oc3cc(-n5c6ccccc6c6ccccc65)ccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H26N4O2/c1-2-11-27(12-3-1)43-46-44(28-21-24-40-36(25-28)32-15-6-9-20-39(32)50-40)48-45(47-43)35-17-10-16-34-33-23-22-29(26-41(33)51-42(34)35)49-37-18-7-4-13-30(37)31-14-5-8-19-38(31)49/h1-26H/i1D,2D,3D,11D,12D |
| InChIKey | DQCOQQAKULIKCD-QJJXXHCMSA-N |
| XLogP | 11.77 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.76 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |