C51H30N4O2 — CID 169060653
3-[9-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]-9-dibenzofuran-3-ylcarbazole (PubChem CID 169060653) has the molecular formula C51H30N4O2 and a molecular weight of 740.89 g/mol. Its IUPAC name is 3-[9-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]-9-dibenzofuran-3-ylcarbazole.
| Compound Name | 3-[9-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]-9-dibenzofuran-3-ylcarbazole |
|---|---|
| PubChem CID | 169060653 |
| Molecular Formula | C51H30N4O2 |
| Molecular Weight | 740.89 g/mol |
| Exact Mass | 740.30 |
| IUPAC Name | 3-[9-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]-9-dibenzofuran-3-ylcarbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])nc(-c3cccc4oc5ccc(-c6ccc7c(c6)c6ccccc6n7-c6ccc7c(c6)oc6ccccc67)cc5c34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C51H30N4O2/c1-3-12-31(13-4-1)49-52-50(32-14-5-2-6-15-32)54-51(53-49)39-18-11-21-46-48(39)41-29-34(23-27-45(41)56-46)33-22-26-43-40(28-33)36-16-7-9-19-42(36)55(43)35-24-25-38-37-17-8-10-20-44(37)57-47(38)30-35/h1-30H/i1D,2D,3D,4D,5D,6D,12D,13D,14D,15D |
| InChIKey | DAYRWTYRFLODKQ-RXOJMXQBSA-N |
| XLogP | 13.44 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.89 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |