C50H30 — CID 171415196
1-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-phenanthren-9-ylpyrene (PubChem CID 171415196) has the molecular formula C50H30 and a molecular weight of 635.82 g/mol. Its IUPAC name is 1-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-phenanthren-9-ylpyrene.
| Compound Name | 1-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-phenanthren-9-ylpyrene |
|---|---|
| PubChem CID | 171415196 |
| Molecular Formula | C50H30 |
| Molecular Weight | 635.82 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | 1-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-phenanthren-9-ylpyrene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3ccc4ccc5c(-c6cc7ccccc7c7ccccc67)ccc6ccc3c4c65)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C50H30/c1-2-12-31(13-3-1)47-39-18-8-10-20-41(39)50(42-21-11-9-19-40(42)47)45-29-25-33-23-27-43-38(26-22-32-24-28-44(45)49(33)48(32)43)46-30-34-14-4-5-15-35(34)36-16-6-7-17-37(36)46/h1-30H/i1D,2D,3D,12D,13D |
| InChIKey | DNAKYJIFFFUXCL-AYAICNHJSA-N |
| XLogP | 14.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.82 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|