C48H30 — CID 153466511
9-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-10-(4-phenanthren-9-ylnaphthalen-1-yl)anthracene (PubChem CID 153466511) has the molecular formula C48H30 and a molecular weight of 613.81 g/mol. Its IUPAC name is 9-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-10-(4-phenanthren-9-ylnaphthalen-1-yl)anthracene.
| Compound Name | 9-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-10-(4-phenanthren-9-ylnaphthalen-1-yl)anthracene |
|---|---|
| PubChem CID | 153466511 |
| Molecular Formula | C48H30 |
| Molecular Weight | 613.81 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | 9-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-10-(4-phenanthren-9-ylnaphthalen-1-yl)anthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3c4ccccc4c(-c4ccc(-c5cc6ccccc6c6ccccc56)c5ccccc45)c4ccccc34)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C48H30/c1-3-17-33-31(14-1)16-13-27-40(33)47-41-23-9-11-25-43(41)48(44-26-12-10-24-42(44)47)45-29-28-39(36-20-6-7-21-37(36)45)46-30-32-15-2-4-18-34(32)35-19-5-8-22-38(35)46/h1-30H/i1D,3D,13D,14D,16D,17D,27D |
| InChIKey | LUURTHROEYJFLI-GHSQCNPASA-N |
| XLogP | 13.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.81 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|