C46H28S — CID 162423781
1-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-phenanthren-9-yldibenzothiophene (PubChem CID 162423781) has the molecular formula C46H28S and a molecular weight of 617.83 g/mol. Its IUPAC name is 1-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-phenanthren-9-yldibenzothiophene.
| Compound Name | 1-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-phenanthren-9-yldibenzothiophene |
|---|---|
| PubChem CID | 162423781 |
| Molecular Formula | C46H28S |
| Molecular Weight | 617.83 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | 1-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-phenanthren-9-yldibenzothiophene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3cccc4sc5c(-c6cc7ccccc7c7ccccc67)cccc5c34)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C46H28S/c1-2-14-29(15-3-1)43-34-20-8-10-22-36(34)44(37-23-11-9-21-35(37)43)39-25-13-27-42-45(39)40-26-12-24-38(46(40)47-42)41-28-30-16-4-5-17-31(30)32-18-6-7-19-33(32)41/h1-28H/i1D,2D,3D,14D,15D |
| InChIKey | SXDKBBJZFUANDF-IRYSBDQPSA-N |
| XLogP | 13.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.83 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|