C46H30 — CID 155641868
1,2,3,4,5,6,8-heptadeuterio-7-naphthalen-1-yl-10-naphthalen-2-yl-9-(3-phenylphenyl)anthracene (PubChem CID 155641868) has the molecular formula C46H30 and a molecular weight of 589.79 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-7-naphthalen-1-yl-10-naphthalen-2-yl-9-(3-phenylphenyl)anthracene.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-7-naphthalen-1-yl-10-naphthalen-2-yl-9-(3-phenylphenyl)anthracene |
|---|---|
| PubChem CID | 155641868 |
| Molecular Formula | C46H30 |
| Molecular Weight | 589.79 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-7-naphthalen-1-yl-10-naphthalen-2-yl-9-(3-phenylphenyl)anthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc(-c4ccccc4)c3)c3c([2H])c(-c4cccc5ccccc45)c([2H])c([2H])c3c(-c3ccc4ccccc4c3)c2c1[2H] |
| InChI | InChI=1S/C46H30/c1-2-12-31(13-3-1)35-18-10-19-37(28-35)46-42-22-9-8-21-41(42)45(38-25-24-32-14-4-5-16-34(32)29-38)43-27-26-36(30-44(43)46)40-23-11-17-33-15-6-7-20-39(33)40/h1-30H/i8D,9D,21D,22D,26D,27D,30D |
| InChIKey | OUISOFYYSPBQIQ-GURGLPDNSA-N |
| XLogP | 12.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.79 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|