C52H34 — CID 155641769
1,2,3,4,5,6,8-heptadeuterio-9-naphthalen-1-yl-7-naphthalen-2-yl-10-[3-(4-phenylphenyl)phenyl]anthracene (PubChem CID 155641769) has the molecular formula C52H34 and a molecular weight of 665.89 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-9-naphthalen-1-yl-7-naphthalen-2-yl-10-[3-(4-phenylphenyl)phenyl]anthracene.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-9-naphthalen-1-yl-7-naphthalen-2-yl-10-[3-(4-phenylphenyl)phenyl]anthracene |
|---|---|
| PubChem CID | 155641769 |
| Molecular Formula | C52H34 |
| Molecular Weight | 665.89 g/mol |
| Exact Mass | 665.31 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-9-naphthalen-1-yl-7-naphthalen-2-yl-10-[3-(4-phenylphenyl)phenyl]anthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc4ccccc34)c3c([2H])c(-c4ccc5ccccc5c4)c([2H])c([2H])c3c(-c3cccc(-c4ccc(-c5ccccc5)cc4)c3)c2c1[2H] |
| InChI | InChI=1S/C52H34/c1-2-12-35(13-3-1)37-24-26-38(27-25-37)41-18-10-19-44(33-41)51-47-21-8-9-22-48(47)52(46-23-11-17-39-15-6-7-20-45(39)46)50-34-43(30-31-49(50)51)42-29-28-36-14-4-5-16-40(36)32-42/h1-34H/i8D,9D,21D,22D,30D,31D,34D |
| InChIKey | XAEGTEGZTKLUDL-CUYSZKEBSA-N |
| XLogP | 14.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.89 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|