C48H32 — CID 155641902
1,2,3,4,5,6,8-heptadeuterio-10-(3,5-diphenylphenyl)-7-naphthalen-1-yl-9-phenylanthracene (PubChem CID 155641902) has the molecular formula C48H32 and a molecular weight of 615.83 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-10-(3,5-diphenylphenyl)-7-naphthalen-1-yl-9-phenylanthracene.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-10-(3,5-diphenylphenyl)-7-naphthalen-1-yl-9-phenylanthracene |
|---|---|
| PubChem CID | 155641902 |
| Molecular Formula | C48H32 |
| Molecular Weight | 615.83 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-10-(3,5-diphenylphenyl)-7-naphthalen-1-yl-9-phenylanthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccccc3)c3c([2H])c(-c4cccc5ccccc45)c([2H])c([2H])c3c(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2c1[2H] |
| InChI | InChI=1S/C48H32/c1-4-15-33(16-5-1)38-29-39(34-17-6-2-7-18-34)31-40(30-38)48-44-25-13-12-24-43(44)47(36-20-8-3-9-21-36)46-32-37(27-28-45(46)48)42-26-14-22-35-19-10-11-23-41(35)42/h1-32H/i12D,13D,24D,25D,27D,28D,32D |
| InChIKey | KHYXTMDQASYOGK-CHISPTAVSA-N |
| XLogP | 13.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.83 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|