C48H32N2O6 — CID 123719609
1,8-diamino-3-(3-naphthalen-2-ylphenyl)-6-(4-naphthalen-1-ylphenyl)pyrene-2,4,5,7,9,10-hexol (PubChem CID 123719609) has the molecular formula C48H32N2O6 and a molecular weight of 732.79 g/mol. Its IUPAC name is 1,8-diamino-3-(3-naphthalen-2-ylphenyl)-6-(4-naphthalen-1-ylphenyl)pyrene-2,4,5,7,9,10-hexol.
| Compound Name | 1,8-diamino-3-(3-naphthalen-2-ylphenyl)-6-(4-naphthalen-1-ylphenyl)pyrene-2,4,5,7,9,10-hexol |
|---|---|
| PubChem CID | 123719609 |
| Molecular Formula | C48H32N2O6 |
| Molecular Weight | 732.79 g/mol |
| Exact Mass | 732.23 |
| IUPAC Name | 1,8-diamino-3-(3-naphthalen-2-ylphenyl)-6-(4-naphthalen-1-ylphenyl)pyrene-2,4,5,7,9,10-hexol |
| SMILES | Nc1c(O)c(-c2ccc(-c3cccc4ccccc34)cc2)c2c(O)c(O)c3c(-c4cccc(-c5ccc6ccccc6c5)c4)c(O)c(N)c4c(O)c(O)c1c2c43 |
| InChI | InChI=1S/C48H32N2O6/c49-41-39-35-36-38(46(54)45(53)37(35)33(43(41)51)26-18-16-25(17-19-26)32-14-6-10-24-8-3-4-13-31(24)32)34(44(52)42(50)40(36)48(56)47(39)55)30-12-5-11-28(22-30)29-20-15-23-7-1-2-9-27(23)21-29/h1-22,51-56H,49-50H2 |
| InChIKey | CSJSFWPUJYMSHF-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.79 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|