C39H24O7 — CID 163478053
8-(11-phenanthren-9-yl-6,7-didehydro-5aH-cyclohepta[b]naphthalen-5-yl)naphthalene-1,2,3,4,5,6,7-heptol (PubChem CID 163478053) has the molecular formula C39H24O7 and a molecular weight of 604.61 g/mol. Its IUPAC name is 8-(11-phenanthren-9-yl-6,7-didehydro-5aH-cyclohepta[b]naphthalen-5-yl)naphthalene-1,2,3,4,5,6,7-heptol.
| Compound Name | 8-(11-phenanthren-9-yl-6,7-didehydro-5aH-cyclohepta[b]naphthalen-5-yl)naphthalene-1,2,3,4,5,6,7-heptol |
|---|---|
| PubChem CID | 163478053 |
| Molecular Formula | C39H24O7 |
| Molecular Weight | 604.61 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | 8-(11-phenanthren-9-yl-6,7-didehydro-5aH-cyclohepta[b]naphthalen-5-yl)naphthalene-1,2,3,4,5,6,7-heptol |
| SMILES | Oc1c(O)c(O)c2c(C3=c4ccccc4=C(c4cc5ccccc5c5ccccc45)C4=CC=CC#CC43)c(O)c(O)c(O)c2c1O |
| InChI | InChI=1S/C39H24O7/c40-33-30(31-32(35(42)37(33)44)36(43)39(46)38(45)34(31)41)29-25-15-3-1-2-14-23(25)28(24-16-8-9-17-26(24)29)27-18-19-10-4-5-11-20(19)21-12-6-7-13-22(21)27/h1-2,4-14,16-18,25,40-46H |
| InChIKey | CCDJPKDRYMETCW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|