C35H26O5 — CID 134256975
6-(6-methyl-12-phenanthren-9-ylbenzo[10]annulen-5-yl)benzene-1,2,3,4,5-pentol (PubChem CID 134256975) has the molecular formula C35H26O5 and a molecular weight of 526.59 g/mol. Its IUPAC name is 6-(6-methyl-12-phenanthren-9-ylbenzo[10]annulen-5-yl)benzene-1,2,3,4,5-pentol.
| Compound Name | 6-(6-methyl-12-phenanthren-9-ylbenzo[10]annulen-5-yl)benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 134256975 |
| Molecular Formula | C35H26O5 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 6-(6-methyl-12-phenanthren-9-ylbenzo[10]annulen-5-yl)benzene-1,2,3,4,5-pentol |
| SMILES | Cc1cccccc(-c2cc3ccccc3c3ccccc23)c2ccccc2c1-c1c(O)c(O)c(O)c(O)c1O |
| InChI | InChI=1S/C35H26O5/c1-20-11-3-2-4-14-26(28-19-21-12-5-6-13-22(21)23-15-7-8-17-25(23)28)24-16-9-10-18-27(24)29(20)30-31(36)33(38)35(40)34(39)32(30)37/h2-19,36-40H,1H3/b3-2-,4-2-,11-3-,14-4+,20-11+,26-14-,26-24+,29-20-,29-27+ |
| InChIKey | FPVYXGIICDCRLX-NKSQVDJQSA-N |
| XLogP | 8.44 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|