C26H16O8 — CID 142377573
8-anthracen-9-yldibenzofuran-1,2,3,4,6,7,9-heptol (PubChem CID 142377573) has the molecular formula C26H16O8 and a molecular weight of 456.41 g/mol. Its IUPAC name is 8-anthracen-9-yldibenzofuran-1,2,3,4,6,7,9-heptol.
| Compound Name | 8-anthracen-9-yldibenzofuran-1,2,3,4,6,7,9-heptol |
|---|---|
| PubChem CID | 142377573 |
| Molecular Formula | C26H16O8 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 8-anthracen-9-yldibenzofuran-1,2,3,4,6,7,9-heptol |
| SMILES | Oc1c(O)c(O)c2c(oc3c(O)c(O)c(-c4c5ccccc5cc5ccccc45)c(O)c32)c1O |
| InChI | InChI=1S/C26H16O8/c27-18-15(14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14)19(28)23(32)25-16(18)17-20(29)21(30)22(31)24(33)26(17)34-25/h1-9,27-33H |
| InChIKey | FNMITDBDOJPWEW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 154.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|