C36H22O22 — CID 166019914
2-[1,2,3,4,5,6,7,8-octahydroxy-10-(2,3,4,5,6-pentahydroxyphenyl)anthracen-9-yl]naphtho[2,3-b][1]benzofuran-1,3,4,6,8,9,10,11-octol (PubChem CID 166019914) has the molecular formula C36H22O22 and a molecular weight of 806.55 g/mol. Its IUPAC name is 2-[1,2,3,4,5,6,7,8-octahydroxy-10-(2,3,4,5,6-pentahydroxyphenyl)anthracen-9-yl]naphtho[2,3-b][1]benzofuran-1,3,4,6,8,9,10,11-octol.
| Compound Name | 2-[1,2,3,4,5,6,7,8-octahydroxy-10-(2,3,4,5,6-pentahydroxyphenyl)anthracen-9-yl]naphtho[2,3-b][1]benzofuran-1,3,4,6,8,9,10,11-octol |
|---|---|
| PubChem CID | 166019914 |
| Molecular Formula | C36H22O22 |
| Molecular Weight | 806.55 g/mol |
| Exact Mass | 806.06 |
| IUPAC Name | 2-[1,2,3,4,5,6,7,8-octahydroxy-10-(2,3,4,5,6-pentahydroxyphenyl)anthracen-9-yl]naphtho[2,3-b][1]benzofuran-1,3,4,6,8,9,10,11-octol |
| SMILES | Oc1cc2c(O)c3oc4c(O)c(O)c(-c5c6c(O)c(O)c(O)c(O)c6c(-c6c(O)c(O)c(O)c(O)c6O)c6c(O)c(O)c(O)c(O)c56)c(O)c4c3c(O)c2c(O)c1O |
| InChI | InChI=1S/C36H22O22/c37-3-1-2-4(19(42)16(3)39)17(40)13-14-18(41)11(26(49)34(57)36(14)58-35(13)15(2)38)5-7-9(22(45)29(52)27(50)20(7)43)6(10-8(5)21(44)28(51)30(53)23(10)46)12-24(47)31(54)33(56)32(55)25(12)48/h1,37-57H |
| InChIKey | PISIXWHYUNEFCC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 437.97 Ų |
| H-Bond Donors | 21 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 21 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|