C44H28O16 — CID 163429697
8-(2,3,4,5,6-pentahydroxyphenyl)-3-[10-(2,3,5,6-tetrahydroxy-4-phenylphenyl)anthracen-9-yl]dibenzofuran-1,2,4,6,7,9-hexol (PubChem CID 163429697) has the molecular formula C44H28O16 and a molecular weight of 812.69 g/mol. Its IUPAC name is 8-(2,3,4,5,6-pentahydroxyphenyl)-3-[10-(2,3,5,6-tetrahydroxy-4-phenylphenyl)anthracen-9-yl]dibenzofuran-1,2,4,6,7,9-hexol.
| Compound Name | 8-(2,3,4,5,6-pentahydroxyphenyl)-3-[10-(2,3,5,6-tetrahydroxy-4-phenylphenyl)anthracen-9-yl]dibenzofuran-1,2,4,6,7,9-hexol |
|---|---|
| PubChem CID | 163429697 |
| Molecular Formula | C44H28O16 |
| Molecular Weight | 812.69 g/mol |
| Exact Mass | 812.14 |
| IUPAC Name | 8-(2,3,4,5,6-pentahydroxyphenyl)-3-[10-(2,3,5,6-tetrahydroxy-4-phenylphenyl)anthracen-9-yl]dibenzofuran-1,2,4,6,7,9-hexol |
| SMILES | Oc1c(O)c(O)c(-c2c(O)c(O)c3oc4c(O)c(-c5c6ccccc6c(-c6c(O)c(O)c(-c7ccccc7)c(O)c6O)c6ccccc56)c(O)c(O)c4c3c2O)c(O)c1O |
| InChI | InChI=1S/C44H28O16/c45-28-24(25-34(51)39(56)41(58)40(57)35(25)52)36(53)42(59)44-26(28)27-37(54)33(50)23(38(55)43(27)60-44)21-17-12-6-4-10-15(17)20(16-11-5-7-13-18(16)21)22-31(48)29(46)19(30(47)32(22)49)14-8-2-1-3-9-14/h1-13,45-59H |
| InChIKey | APLCJHDWPQCNIT-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 316.59 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.69 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|