C28H18O4 — CID 132583689
1,4-diphenylnaphtho[1,2-b][1]benzofuran-2,3,10-triol (PubChem CID 132583689) has the molecular formula C28H18O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 1,4-diphenylnaphtho[1,2-b][1]benzofuran-2,3,10-triol.
| Compound Name | 1,4-diphenylnaphtho[1,2-b][1]benzofuran-2,3,10-triol |
|---|---|
| PubChem CID | 132583689 |
| Molecular Formula | C28H18O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1,4-diphenylnaphtho[1,2-b][1]benzofuran-2,3,10-triol |
| SMILES | Oc1c(O)c(-c2ccccc2)c2c(ccc3c4cccc(O)c4oc32)c1-c1ccccc1 |
| InChI | InChI=1S/C28H18O4/c29-21-13-7-12-18-19-14-15-20-22(16-8-3-1-4-9-16)25(30)26(31)23(17-10-5-2-6-11-17)24(20)28(19)32-27(18)21/h1-15,29-31H |
| InChIKey | VWPNQHUUJYFTFE-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|