C48H30O13 — CID 161266318
7-[10-(2,3,6-trihydroxy-4,5-diphenylphenyl)anthracen-9-yl]naphtho[5,6-b][1]benzofuran-1,2,3,4,5,6,8,9,10-nonol (PubChem CID 161266318) has the molecular formula C48H30O13 and a molecular weight of 814.76 g/mol. Its IUPAC name is 7-[10-(2,3,6-trihydroxy-4,5-diphenylphenyl)anthracen-9-yl]naphtho[5,6-b][1]benzofuran-1,2,3,4,5,6,8,9,10-nonol.
| Compound Name | 7-[10-(2,3,6-trihydroxy-4,5-diphenylphenyl)anthracen-9-yl]naphtho[5,6-b][1]benzofuran-1,2,3,4,5,6,8,9,10-nonol |
|---|---|
| PubChem CID | 161266318 |
| Molecular Formula | C48H30O13 |
| Molecular Weight | 814.76 g/mol |
| Exact Mass | 814.17 |
| IUPAC Name | 7-[10-(2,3,6-trihydroxy-4,5-diphenylphenyl)anthracen-9-yl]naphtho[5,6-b][1]benzofuran-1,2,3,4,5,6,8,9,10-nonol |
| SMILES | Oc1c(O)c(-c2ccccc2)c(-c2ccccc2)c(O)c1-c1c2ccccc2c(-c2c(O)c(O)c(O)c3oc4c5c(O)c(O)c(O)c(O)c5c(O)c(O)c4c23)c2ccccc12 |
| InChI | InChI=1S/C48H30O13/c49-35-25(19-11-3-1-4-12-19)26(20-13-5-2-6-14-20)36(50)38(52)31(35)28-23-17-9-7-15-21(23)27(22-16-8-10-18-24(22)28)29-30-33-41(55)39(53)32-34(42(56)44(58)43(57)40(32)54)47(33)61-48(30)46(60)45(59)37(29)51/h1-18,49-60H |
| InChIKey | VDFSGJXOCXKKCL-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 255.90 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.76 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|