C50H30O10 — CID 163577288
7-[3-(10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]naphtho[5,6-b][1]benzofuran-1,2,3,4,5,6,8,9,10-nonol (PubChem CID 163577288) has the molecular formula C50H30O10 and a molecular weight of 790.78 g/mol. Its IUPAC name is 7-[3-(10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]naphtho[5,6-b][1]benzofuran-1,2,3,4,5,6,8,9,10-nonol.
| Compound Name | 7-[3-(10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]naphtho[5,6-b][1]benzofuran-1,2,3,4,5,6,8,9,10-nonol |
|---|---|
| PubChem CID | 163577288 |
| Molecular Formula | C50H30O10 |
| Molecular Weight | 790.78 g/mol |
| Exact Mass | 790.18 |
| IUPAC Name | 7-[3-(10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]naphtho[5,6-b][1]benzofuran-1,2,3,4,5,6,8,9,10-nonol |
| SMILES | Oc1c(O)c(-c2cc(-c3c4ccccc4c(-c4cccc5ccccc45)c4ccccc34)cc3ccccc23)c2c(oc3c4c(O)c(O)c(O)c(O)c4c(O)c(O)c32)c1O |
| InChI | InChI=1S/C50H30O10/c51-40-35(36-38-43(54)41(52)37-39(44(55)46(57)45(56)42(37)53)49(38)60-50(36)48(59)47(40)58)32-21-24(20-23-11-2-4-14-26(23)32)33-28-15-5-7-17-30(28)34(31-18-8-6-16-29(31)33)27-19-9-12-22-10-1-3-13-25(22)27/h1-21,51-59H |
| InChIKey | GEOWUBMIZAOEAC-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 195.21 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.78 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|